Avanafil
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-05671 |
| Alternative Name(s) | (S)-2-(2-Hydroxymethyl-1-pyrrolidinyl)-4-2-pyrimidinylmethdine; 4-[[(3chloro-4-methoxyphenyl)methyl] |
| Research Area | Avanafil is an orally available phosphodiesterase type 5 (PDE5) inhibitor with vasodilatory activity. Avanafil selectively inhibits PDE5, thus inhibiting the degradation of cyclic guanosine monophosphate (cGMP) found in the smooth muscle of the corpus cav |
| Molecular Formula | C23H2ClN7O3 |
| CAS# | 330784-47-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC[C@H](CCC1)N1C2=NC=C(C(NCC3=NC=CC=N3)=O)C(NCC4=CC(Cl)=C(OC)C=C4)=N2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05671.html |
| Additional Information | NULL |