Quetiapine Sulfone
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-10375 |
| Alternative Name(s) | Quetiapine Sulfone; |
| Research Area | An impurity of the antipsychotic Quetiapine .;Impurity in commercial preparations of Quetiapine |
| Molecular Formula | C21H25N3O4S |
| CAS# | 329216-65-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S]1(C2=CC=CC=C2C(N3CCN(CCOCCO)CC3)=NC4=CC=CC=C14)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10375.html |
| Additional Information | NULL |