Racepinephrine/Adrenaline HCL
(±)-Epinephrine is a natural neurotransmitter that is released from the adrenal medulla and activates adrenoceptors (Kis = 15, 735, and 3,970 nM for α1A-, β2-, and β1-adrenergic receptors, respectively). (±)-Epinephrine hydrochloride is an adrenergic receptor agonist.
| Catalog Number | API329635 |
| Alternative Name(s) | Racepinephrine hydrochloride DL-ADRENALINE HYDROCHLORIDE (+/-)-Epinephrine hydrochloride Asthmanefrin |
| Research Area | APIs for Chronic Cardiac Insufficiency |
| Molecular Formula | C9H14ClNO3 |
| CAS# | 329-63-5 |
| SMILES | CNCC(C1=CC(=C(C=C1)O)O)O.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/racepinephrineadrenaline-hcl-item-11591.html |