4E1RCat
4E1RCat blocks interaction between eIF4E:eIF4G and eIF4E:4E-BP1, prevents assembly of the eIF4F complex and inhibits cap-dependent translation with IC50 ~4 μM.
| Trivial name | eIF4E/eIF4G Interaction Inhibitor II |
| Catalog Number | CSN18215 |
| Alternative Name(s) | eIF4E/eIF4G Interaction Inhibitor II |
| Research Area | Cancer |
| Molecular Formula | C28H18N2O6 |
| CAS# | 328998-25-0 |
| Purity | ≥98% |
| SMILES | O=C(O)C1=CC=C(N2C(/C(C=C2C3=CC=CC=C3)=C\C4=CC=C(C5=CC=C([N+]([O-])=O)C=C5)O4)=O)C=C1 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/4e1rcat.html |
