Mecillinam
Mecillinam is an extended-spectrum penicillin antibiotic that binds specifically to penicillin binding protein 2 (PBP2), and is only considered to be active against Gram-negative bacteria.
| Trivial name | Mecillinam Penicillin HX; Coactin; Hexacillin |
| Catalog Number | CSN11365 |
| Alternative Name(s) | Mecillinam Penicillin HX; Coactin; Hexacillin |
| Research Area | Infection |
| Molecular Formula | C15H23N3O3S |
| CAS# | 32887-01-7 |
| Purity | ≥95% |
| SMILES | O=C([C@@H](C(C)(C)S[C@]1([H])[C@@H]2/N=C/N3CCCCCC3)N1C2=O)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/mecillinam.html |