Chlorogenic acid
Chlorogenic acid is a bioactive polyphenolic compound mainly found in many plants, such as coffee. It is a potent neuroprotectant and also possesses antiviral, antifungal, antioxidant and antitumor properties. CGA may also be involved in regulating glucose and lipid metabolism and improving insulin sensitivity.
| Catalog Number | CDC10-0040 |
| Alternative Name(s) | CGA, 1,4,5-Trihydroxycyclohexanecarboxylic acid 3-(3,4-dihydroxycinnamate), 3-(3,4-Dihydroxycinnamoyl)quinic acid |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C16H18O9 |
| CAS# | 327-97-9 |
| Inchi | 1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 |
| SMILES | O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\c2ccc(O)c(O)c2)[C@@H]1O)C(O)=O |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/chlorogenic-acid-item-2122.html |