Chlorogenic acid 5g
Chlorogenic acid is an important intermediate in lignin biosynthesis. This compound, long known as an antioxidant, also slows the release of glucose into the bloodstream after a meal.
| Trivial name | Chlorogenic acid 5g |
| Catalog Number | A10202-5000 |
| Alternative Name(s) | (1S,3R,4R,5R)-3-{[(2Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexanecarboxylic acid |
| Molecular Formula | C16H18O9 |
| CAS# | 327-97-9 |
| SMILES | C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O |
| Size | 5000mg |
| Supplier Page | http://www.adooq.com/chlorogenic-acid.html |