Mesoridazine Besylate
Mesoridazine besylate is a phenothiazine dopamine receptor anatagonist. Mesoridazine besylate is described to demonstrate inhibition for D2DR and D4DR. It has a high affinity for dopamine D4 receptor. Mesoridazine besylate is an antipsychotic agent.
| Trivial name | / |
| Catalog Number | CSN23832 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C27H32N2O4S3 |
| CAS# | 32672-69-8 |
| Purity | ≥98% |
| SMILES | O=S(C(C=C1N2CCC3N(C)CCCC3)=CC=C1SC4=C2C=CC=C4)C.O=S(C5=CC=CC=C5)(O)=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/mesoridazine-besylate.html |