L67
L67 (DNA Ligase Inhibitor) is a competitive inhibitor of DNA ligase that effectively targets both DNA ligases I and III, with an IC50 of 10 μM for both enzymes. It specifically disrupts mitochondrial DNA metabolism in cancer cells. Inhibition of DNA ligase IIIα (LigIIIα) by L67 leads to significant alterations in mitochondrial morphology, reduces mitochondrial DNA levels, and increases reactive oxygen species (ROS).
| Trivial name | DNA Ligase Inhibitor |
| Catalog Number | E7688 |
| Molecular Formula | C13H12N2O2.HCl |
| CAS# | 325970-71-6 |
| Inchi | InChI=1S/C13H12N2O2.ClH/c16-13(17)6-5-11-1-3-12(4-2-11)9-15-8-7-14-10-15;/h1-8,10H,9H2,(H,16,17);1H/b6-5+; |
| Inchi Key | CWKFWBJJNNPGAM-IPZCTEOASA-N |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)C=CC(=O)O.Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/l67.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E7688-L67-chemical-structure.png |
