EIDD-1931
EIDD-1931 has a broad-spectrum antiviral activity against multiple coronaviruses, including SARS-CoV2, MERS-CoV, SARS-CoV. and related zoonotic group 2b or 2c Bat-CoVs, as well as increased potency against a coronavirus bearing resistance mutations to another nucleoside analog inhibitor.
| Trivial name | β-D-N4-hydroxycytidine |
| Catalog Number | CSN25552 |
| Alternative Name(s) | β-D-N4-hydroxycytidine |
| Research Area | Infection |
| Molecular Formula | C9H13N3O6 |
| CAS# | 3258-02-4 |
| Purity | ≥99% |
| SMILES | O=C1N/C(C=CN1[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)=N/O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/eidd-1931.html |