BPIPP
guanylyl cyclase (GC) and adenylyl cyclase (AC) inhibitor Others|Guanylyl Cyclase
| Catalog Number | B7449-5 |
| Research Area | Others|Guanylyl Cyclase |
| Molecular Formula | C22H16BrN3O3 |
| CAS# | 325746-94-9 |
| Purity | 98% |
| SMILES | BrC1=CC([C@H]2C3=C(C4=CC=CC=C4C3=O)NC(N(C)C5=O)=C2C(N5C)=O)=CC=C1 |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7449 |
