6-Epidoxycycline
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-05768 |
| Alternative Name(s) | 6-Epidoxycycline;Doxycycline Related Compound A;6-Deoxy-6-epioxytetracycline;(4S,4aR,5S,5aR,6S,12aS)-4-(Dimethylamino)-1,4,4a,5,5a,6,11,12a-ctahydro -3,5,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-2-naphthcencarboxamide; 6-Deoxy-6-epioxytetrccline; 6-epi-Doxccline; epi-Doxccline |
| Research Area | One of the Doxycycline decomposition products. |
| Molecular Formula | C22H24N2O8 |
| CAS# | 3219-99-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](C(O)=C(C(C1=C2C=CC=C1O)=O)[C@]([C@@H]2C)([H])[C@@H]3O)(C(C(C(N)=O)=C4O)=O)[C@]3([H])[C@@H]4N(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05768.html |
| Additional Information | NULL |