Azacitidine(Vidaza) 10mM * 1mL in DMSO
Azacitidine is a chemical analogue of the cytosine nucleoside used in DNA and RNA that is mainly used in the treatment of myelodysplastic syndrome (MDS).
| Trivial name | Azacitidine(Vidaza) 10mM * 1mL in DMSO |
| Catalog Number | A10105-10mM-D |
| Alternative Name(s) | 4-amino-1-??-D-ribofuranosyl-1,3,5-triazin-2(1H)-one |
| Molecular Formula | C8H12N4O5 |
| CAS# | 320-67-2 |
| SMILES | C1=NC(=NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/azacitidine-vidaza.html |