Axitinib 13C D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11922 |
| Alternative Name(s) | N-(13C,D3)methyl-2-({3-[(E)-2-(pyridin-2- yl)ethenyl]-1H-indazol-6-yl}sulfanyl)benzamide; 1261432-00-1 |
| Research Area | Labeled Axitinib, intended for use as an internal standard for the quantification of Axitinib by GC- or LC-mass spectrometry. |
| Molecular Formula | C21[13C]H15D3N4OS |
| CAS# | 319460-85-0 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N[13C]([2H])([2H])[2H])C1=C(C=CC=C1)SC2=CC=C3C(/C=C/C4=CC=CC=N4)=NNC3=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11922.html |
| Additional Information | NULL |