Axitinib
Axitinib is a multi-target inhibitor of VEGFR1, VEGFR2, VEGFR3, PDGFRβ and c-Kit with IC50 of 0.1 nM, 0.2 nM, 0.1-0.3 nM, 1.6 nM and 1.7 nM in Porcine aorta endothelial cells, respectively.
| Trivial name | AG 013736 |
| Catalog Number | CSN10361 |
| Alternative Name(s) | AG 013736 |
| Research Area | Cancer |
| Molecular Formula | C22H18N4OS |
| CAS# | 319460-85-0 |
| Purity | ≥99% |
| SMILES | O=C(NC)C1=CC=CC=C1SC2=CC3=C(C=C2)C(/C=C/C4=NC=CC=C4)=NN3 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/axitinib.html |
