Levomefolic Acid D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-01250 |
| Alternative Name(s) | (2S)-2-{[4-({[(6S)-2-amino-5-(D3)methyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)phenyl]formamido}pentanedioic acid |
| Research Area | Labeled Levomefolic Acid, intended for use as an internal standard for the quantification of Levomefolic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C20H22N7O6D3 |
| CAS# | 31690-09-2(Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=C(NC(N)=N1)NC[C@H](CNC3=CC=C(C(N[C@H](C(O)=O)CCC(O)=O)=O)C=C3)N2C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01250.html |
| Additional Information | NULL |