Levomefolic acid 50mg
Levomefolic acid is the natural, active form of folic acid used at the cellular level for DNA reproduction, the cysteine cycle and the regulation of homocysteine among other functions.
| Trivial name | Levomefolic acid 50mg |
| Catalog Number | A15144-50 |
| Alternative Name(s) | (2S)-2-[[4-[[(6S)-2-amino-5-methyl-4-oxo-1,6,7,8-tetrahydropteridin-6-yl]methylamino]benzoyl]amino]pentanedioic acid |
| Molecular Formula | C20H25N7O6 |
| CAS# | 31690-09-2 |
| SMILES | CN1C(CNC2=C1C(=O)N=C(N2)N)CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/levomefolic-acid.html |