5-Fluorouridine
5-fluorouridine is also known as FUrd, 5-Fluorouracil 1-beta-D-ribofuranoside, 5-Fur, or 5-Fluoro-uridine. 5-fluorouridine is a solid. This compound belongs to the pyrimidine nucleosides and analogues. These are compounds comprising a pyrimidine base attached to a sugar. 5-fluorouridine is known to target uridine phosphorylase. FUrd is often used in chemical and biochemical comparison studies with fluorouracil and thymine analogs.
| Catalog Number | T1349 |
| Research Area | Cell Cycle/Checkpoint|||DNA Damage/DNA Repair|||Others |
| Molecular Formula | C9H11FN2O6 |
| CAS# | 316-46-1 |
| Purity | 99.53% |
| SMILES | [C@H]1(n2c(=O)[nH]c(=O)c(c2)F)[C@@H]([C@@H]([C@H](O1)CO)O)O |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/5-Fluorouridine |
| Additional Information | https://www.targetmol.com/datasheet/T1349 |
