PTC-209 10mM * 1mL in DMSO
PTC-209 is a novel potent and selective BMI-1 inhibitor, targeting the BMI-1 self-renewal machinery with an IC50 of ~0.5 ?M.
| Trivial name | PTC-209 10mM * 1mL in DMSO |
| Catalog Number | A13826-10mM-D |
| Alternative Name(s) | N-(2,6-dibromo-4-methoxyphenyl)-4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)thiazol-2-amine |
| Molecular Formula | C17H13Br2N5OS |
| CAS# | 315704-66-6 |
| SMILES | CC1=C(N2C=CC=NC2=N1)C3=CSC(=N3)NC4=C(C=C(C=C4Br)OC)Br |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ptc-209.html |