DL- Kavain
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-30614 |
| Alternative Name(s) | (E)-4-methoxy-6-styryl-5,6-dihydro-2H-pyran-2-one |
| Research Area | Kavain is known to exhibit anticonvulsive properties by attenuating vascular smooth muscle contraction through interactions with voltage-dependent sodium and calcium channels. |
| Molecular Formula | C14H14O3 |
| CAS# | 3155-48-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1OC(CC(OC)=C1)/C=C/C2=CC=CC=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30614.html |
| Additional Information | NULL |