PenCB | MedChemExpress (MCE)
PenCB (PCB 118) could induces pyroptosis by priming and activating NFκB-dependent NLRP3 inflammasome. PCB 118 induces oxidative stress and pyroptosis are dependent on Aryl hydrocarbon receptor (AhR) activation and subsequent cytochrome P450 1A1 upregulation[1].
| Trivial name | PenCB |
| Catalog Number | HY-117532 |
| Alternative Name(s) | PCB 118 |
| Research Area | Cancer |
| CAS# | 31508-00-6 |
| Purity | ≥98.0% |
| SMILES | ClC1=C(C=C(C(C2=CC=C(C(Cl)=C2)Cl)=C1)Cl)Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pencb.html |