Nocodazole
Nocodazole is a rapidly-reversible inhibitor of microtubule polymerization, also inhibits Abl, Abl (E255K) and Abl (T315I) with IC50 of 0.21 μM, 0.53 μM and 0.64 μM, respectively.
| Trivial name | Oncodazole; R17934 |
| Catalog Number | CSN11569 |
| Alternative Name(s) | Oncodazole; R17934 |
| Research Area | Cancer |
| Molecular Formula | C14H11N3O3S |
| CAS# | 31430-18-9 |
| Purity | ≥99% |
| SMILES | O=C(OC)NC1=NC2=CC=C(C(C3=CC=CS3)=O)C=C2N1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/nocodazole.html |
