FLI-06 10mg
FLI-06 is a Notch inhibitor and the early secretory pathway inhibitor. FLI-06 disrupts the Golgi apparatus in a manner distinct from that of brefeldin A and golgicide A.
Trivial name | FLI-06 10mg |
Catalog Number | A13815-10 |
Alternative Name(s) | cyclohexyl 2,7,7-trimethyl-4-(4-nitrophenyl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
Molecular Formula | C25H30N2O5 |
CAS# | 313967-18-9 |
SMILES | CC1=C(C(C2=C(N1)CC(CC2=O)(C)C)C3=CC=C(C=C3)[N+](=O)[O-])C(=O)OC4CCCCC4 |
Size | 10mg |
Supplier Page | http://www.adooq.com/fli-06.html |