Regadenoson
Regadenoson is a selective adenosine A2A receptor agonist with Ki value of 1.1nM for pig striatum A2A receptor, used as a novel pharmacologic stress agent under clinical development for myocardial perfusion imaging.
| Trivial name | CVT-3146; Lexiscan |
| Catalog Number | CSN15960 |
| Alternative Name(s) | CVT-3146; Lexiscan |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C15H18N8O5 |
| CAS# | 313348-27-5 |
| Purity | ≥99% |
| SMILES | CNC(C1=CN(C2=NC(N)=C3C(N([C@H]4[C@H](O)[C@H](O)[C@@H](CO)O4)C=N3)=N2)N=C1)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/regadenoson.html |
