JNK Inhibitor IX
JNK Inhibitor IX can selectively inhibit JNK2 and JNK3 through targeting the ATP binding site with pIC50 of 6.5 and 6.7, respectively.
| Trivial name | TCS JNK 5a |
| Catalog Number | CSN15772 |
| Alternative Name(s) | TCS JNK 5a |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C20H16N2OS |
| CAS# | 312917-14-9 |
| Purity | ≥98% |
| SMILES | O=C(NC1=C(C#N)C(CCCC2)=C2S1)C3=C4C=CC=CC4=CC=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/jnk-inhibitor-ix.html |