Hygromycin B
Hygromycin B is a fda approved antibiotic food additive for swine and poultry Hygromycin B is an antibiotic produced by the bacterium Streptomyces hygroscopicus. It is an aminoglycoside that kills bacteria, fungi and higher eukaryotic cells by inhibiting protein synthesis.
| Catalog Number | Z10-101-165 |
| Alternative Name(s) | Hygromycin b |
| Research Area | Hygromycin B, as an antibiotic, used for selection of cells transfected with E. coli hygromycin resistance gene. |
| Molecular Formula | C20H37N3O13 |
| CAS# | 31282-04-9 |
| Purity | >98% |
| Inchi | InChI=1S/C20H37N3O13/c1-23-7-2-5(21)9(26)15(10(7)27)33-19-17-16(11(28)8(4-25)32-19)35-20(36-17)18(31)13(30)12(29)14(34-20)6(22)3-24/h5-19,23-31H,2-4,21-22H2,1H3/t5-,6-,7+,8-,9+,10-,11+,12-,13+,14-,15-,16+,17+,18-,19+,20+/m1/s1 |
| Inchi Key | GRRNUXAQVGOGFE-XKIAHZFYSA-N |
| SMILES | CN[C@H]1C[C@H]([C@@H]([C@H]([C@@H]1O)O[C@H]2[C@@H]3[C@H]([C@H]([C@H](O2)CO)O)O[C@]4(O3)[C@@H]([C@H]([C@H]([C@H](O4)[C@@H](CO)N)O)O)O)O)N |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/hygromycin-b-item-z10-101-165-34597.html |