MID-1
MID-1 is a disruptor of MG53-IRS-1 (Mitsugumin 53-insulin receptor substrate-1) interaction, which can disrupts molecular association of MG53 with IRS-1 and abolishes MG53-induced IRS-1 ubiquitination and degradation in skeletal muscle, leading to elevated IRS-1 expression level and increased insulin signaling and glucose uptake.
| Catalog Number | E0794 |
| Molecular Formula | C12H11N3O4S |
| CAS# | 312608-54-1 |
| SMILES | CCOC1=CC=C(C=C1)C(=O)NC2=NC=C(S2)[N+]([O-])=O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/mid-1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0794-mid-1-chemical-structure.gif |