Tetrakis(2-Ethylhexyl) Benzene-1,2,4,5-Tetracarboxylate

Tetrakis(2-ethylhexyl) benzene-1,2,4,5-tetracarboxylate is a coagulant agent that can be used in the production of polyvinyl chloride. It stabilizes and prevents the formation of unwanted particles in the polymerization process by preventing the agglomeration of polymer chains. Tetrakis(2-ethylhexyl) benzene-1,2,4,5-tetracarboxylate also acts as an anti-aging agent for polyvinyl chloride and prevents deterioration due to oxidation. This compound is not soluble in water or organic solvents and has a high melting point.

Catalog Number ABA-061
CAS# 3126-80-5
SMILES CCCCC(CC)COC(=O)C1=CC(=C(C=C1C(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC
Size Inquiry
Supplier Page https://www.agingclocks.com/tetrakis2-ethylhexyl-benzene-1245-tetracarboxylate-item-1931.html