Dexamethasone 21-Phosphate D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-13837 |
| Alternative Name(s) | {2-[(1R,2S,10S,11S,13R,14R,15S,17S)-1-fluoro-14,17- dihydroxy-2,13,15-trimethyl-5-oxo(6,8- D2)tetracyclo[8.7.0.05]heptadeca-3,6- dien-14-yl]-2-oxo(D2)ethoxy}phosphonic acid |
| Research Area | Labeled Dexamethasone , intended for use as an internal standard for the quantification of Dexamethasone by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H26D4FO8P |
| CAS# | 312-93-6 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@]2(O)C(C([2H])([2H])O[P](O)(O)=O)=O)[C@](C[C@H]2C)([H])[C@@](CC([2H])C3=C([2H])C4=O)([H])[C@@](F)([C@]3(C=C4)C)[C@@H](O)C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13837.html |
| Additional Information | NULL |