Triiodothyronine sulfate | MedChemExpress (MCE)
Triiodothyronine sulfate is the main metabolite of thyroid hormone triiodothyronine (T3). Triiodothyronine is an active form of thyroid hormone, which binds to β1 thyroid hormone receptor (TRβ1), and activates its activity[1][2].
| Trivial name | Triiodothyronine sulfate |
| Catalog Number | HY-126996 |
| Research Area | Metabolic Disease |
| CAS# | 31135-55-4 |
| Purity | ≥98.0% |
| SMILES | N[C@@H](CC1=CC(I)=C(OC2=CC=C(OS(=O)(O)=O)C(I)=C2)C(I)=C1)C(O)=O |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/triiodothyronine-sulfate.html |