Ibuprofen sodium
Ibuprofen ((±)-Ibuprofen sodium) sodium is an orally active, selective inhibitor of COX-1 with an IC50 value of 13 μM. Ibuprofen formulated as a sodium salt is absorbed twice as quickly as from its standard ibuprofen acid.
| Trivial name | (±)-Ibuprofen sodium |
| Catalog Number | E6027 |
| Molecular Formula | C13H17N5O8S2 |
| CAS# | 31121-93-4 |
| Inchi | InChI=1S/C13H17N5O8S2/c1-5-7(10(20)18(5)28(23,24)25)16-9(19)8(6-4-27-12(14)15-6)17-26-13(2,3)11(21)22/h4-5,7H,1-3H3,(H2,14,15)(H,16,19)(H,21,22)(H,23,24,25)/b17-8-/t5-,7-/m0/s1 |
| Inchi Key | WZPBZJONDBGPKJ-VEHQQRBSSA-N |
| SMILES | CC1C(C(=O)N1S(=O)(=O)O)NC(=O)C(=NOC(C)(C)C(=O)O)C2=CSC(=N2)N |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/ibuprofen-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E6027-Ibuprofen-sodium-chemical-structure.png |