Ibuprofen sodium
Ibuprofen ((±)-Ibuprofen sodium) sodium is an orally active, selective inhibitor of COX-1 with an IC50 value of 13 μM. Ibuprofen formulated as a sodium salt is absorbed twice as quickly as from its standard ibuprofen acid.
| Trivial name | (±)-Ibuprofen sodium |
| Catalog Number | E6027 |
| Molecular Formula | C10H14N4O4 |
| CAS# | 31121-93-4 |
| Inchi | InChI=1S/C10H14N4O4/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15/h5-6,15-16H,3-4H2,1-2H3 |
| Inchi Key | KSCFJBIXMNOVSH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(CO)O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/ibuprofen-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E6027-Ibuprofen-sodium-chemical-structure.png |
