PRT 4165
Bmi1/Ring1A-mediated ubiquitination inhibitor Ubiquitination/ Proteasome|E3 Ligase
| Catalog Number | B5797-5 |
| Research Area | Ubiquitination/ Proteasome|E3 Ligase |
| Molecular Formula | C15H9NO2 |
| CAS# | 31083-55-3 |
| Purity | 98% |
| SMILES | O=C1C2=CC=CC=C2C(/C1=C/C3=CC=CN=C3)=O |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B5797 |
