ABTS Diammonium
ABTS Diammonium salt is a chemical compound used to observe the reaction kinetics of specific enzymes and a common use for it is in the ELISA to detect for binding of molecules to each other.

Trivial name | AzBTS-(NH4)2 |
Catalog Number | CSN10197 |
Alternative Name(s) | AzBTS-(NH4)2 |
Research Area | / |
Molecular Formula | C18H24N6O6S4 |
CAS# | 30931-67-0 |
Purity | ≥99% |
SMILES | O=S(C1=CC=C2N(CC)/C(SC2=C1)=N/N=C3SC4=CC(S(=O)([O-])=O)=CC=C4N\3CC)([O-])=O.[NH4+].[NH4+] |
Size | 250mg |
Supplier Page | https://www.csnpharm.com/products/abts-diammonium.html |