Inauhzin
Inauhzin(INZ) is a novel small molecule that effectively reactivates p53 by inhibiting SIRT1 activity, promotes p53-dependent apoptosis of human Y cells without causing apparently genotoxic stress(IC50=3 uM, in A549 cell).
| Catalog Number | T1887 |
| Alternative Name(s) | INZ |
| Research Area | DNA Damage/DNA Repair|||Chromatin/Epigenetic |
| Molecular Formula | C25H19N5OS2 |
| CAS# | 309271-94-1 |
| Purity | 98.00% |
| SMILES | CCC(SC1=NC2=C(N=N1)C1=C(N2)C=CC=C1)C(=O)N1C2=C(SC3=C1C=CC=C3)C=CC=C2 |
| Size | 10 mg |
| Supplier Page | https://www.targetmol.com/compound/Inauhzin |
| Additional Information | https://www.targetmol.com/datasheet/T1887 |