L-Cystine dihydrochloride
L-Cystine is a non-essential amino acid for human development. L-Cystine is formed by the dimerization of two cysteines through the sulfur.
| Catalog Number | PIPB-0102 |
| Alternative Name(s) | L-Cystine dihydrochloride L-CYSTINE 2HCL L-Cystine (dihydrochloride) cystine dihydrochloride |
| Research Area | Amino acids and derivatives |
| Molecular Formula | C6H14Cl2N2O4S2 |
| CAS# | 30925-07-6 |
| SMILES | C(C(C(=O)O)N)SSCC(C(=O)O)N.Cl.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/l-cystine-dihydrochloride-item-10220.html |