Aldrin
Marine
| Trivial name | NULL |
| Catalog Number | CS-T-47503 |
| Alternative Name(s) | (1R,4S,8S,8aS)-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene |
| Research Area | Aldrin is a chlorinated cyclodiene pesticide that is widely used to maintain control of pests and insects from crops. The use of Aldrin has been regulated and controlled in the early 1970's with fears of bioaccumulation in the environment and possible carcinogenicity. |
| Molecular Formula | C12H8Cl6 |
| CAS# | 309-00-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | Cl[C@]1(C(Cl)=C2Cl)[C@]([C@@]3([H])C[C@]4([H])C=C3)([H])[C@]4([H])[C@]2(Cl)C1(Cl)Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST47503.html |
| Additional Information | NULL |