Pigment red 202 | MedChemExpress (MCE)
Pigment Red 202 is a commonly used commercial dye for bulk coloring of plastics and synthetic fibers and for surface coatings such as paints and inks.
| Trivial name | Pigment red 202 |
| Catalog Number | HY-D1233 |
| Alternative Name(s) | Quinaridone magenta 202 |
| CAS# | 3089-17-6 |
| Purity | ≥98.0% |
| SMILES | O=C(C(C=C1NC2=C3C=C(Cl)C=C2)=C4C=C1C3=O)C5=C(N4)C=CC(Cl)=C5 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pigment-red-202.html |