Zalypsis | MedChemExpress (MCE)
Zalypsis (PM00104) has anti-tumor activity. Zalypsis binds to DNA and shows cytotoxicity. Zalypsis inhibits cell cycle and transcription, and leads to double stranded DNA breaks[1][2].
| Trivial name | Zalypsis |
| Catalog Number | HY-16401 |
| Alternative Name(s) | PM00104 |
| Research Area | Cancer |
| CAS# | 308359-57-1 |
| Purity | ≥98.00% |
| SMILES | O=C(NC[C@H]1C2=C3C(OCO3)=C(C)C(OC(C)=O)=C2C[C@]4([H])N1[C@@H](O)[C@@]5([H])N(C)[C@]4([H])C6=C(C5)C=C(C)C(OC)=C6O)/C=C/C7=CC(C(F)(F)F)=CC=C7 |
| PubChem Chemical Structure ID | 16061448 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zalypsis.html |