Polycytidylic Acid
A group of cytosine ribonucleotides in which the phosphate residues of each cytosine ribonucleotide act as bridges in forming diester linkages between the ribose moieties.
| Catalog Number | PIPB-0760 |
| Alternative Name(s) | Cytosine arabinoside monophosphate NSC99445 [5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| Research Area | ProteinsBiomaterials |
| Molecular Formula | C9H14N3O8P |
| CAS# | 30811-80-4 |
| SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/polycytidylic-acid-item-11682.html |