L-Theanine
L-theanine is an amino acid found most commonly in tea leaves and binds to ionotropic glutamate receptors in the micromolar range, including the AMPA and kainate receptors and, to a lesser extent, the NMDA receptor.
| Trivial name | Theanine |
| Catalog Number | CSN16600 |
| Alternative Name(s) | Theanine |
| Research Area | / |
| Molecular Formula | C7H14N2O3 |
| CAS# | 3081-61-6 |
| Purity | ≥99% |
| SMILES | O=C(O)[C@@H](N)CCC(NCC)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/l-theanine.html |