9,10-Anthracenediyl-bis(methylene)dimalonic acid
9,10-Anthracenediyl-bis(methylene)dimalonic acid (ABMDMA) is a biological dye and indicator used to detect singlet oxygen generation (SOG). 9,10-Anthracenediyl-bis(methylene)dimalonic acid is water-soluble derivative of anthracene. 9,10-Anthracenediyl-bis(methylene)dimalonic acid can be photobleached by singlet oxygen to its corresponding endoperoxide. This reaction can be monitored spectrophotometrically by recording the decrease of absorbance at 400 nm.
Trivial name | ABMDMA |
Catalog Number | E7325 |
Molecular Formula | C7H16NO2.Cl |
CAS# | 307554-62-7 |
Inchi | InChI=1S/C7H16NO2.ClH/c1-7(9)10-6-5-8(2,3)4;/h5-6H2,1-4H3;1H/q+1;/p-1 |
Inchi Key | JUGOREOARAHOCO-UHFFFAOYSA-M |
SMILES | CC(=O)OCC[N+](C)(C)C.[Cl-] |
Size | 25mg |
Supplier Page | http://www.selleckchem.com/products/9-10-anthracenediyl-bis-methylene-dimalonic-acid.html |
Additional Information | https://file.selleck.cn/downloads/struct/e7325-9-10-anthracenediyl-bis-methylene-dimalonic-acid-chemical-structure-tube.png |