3′-N3-ddT (AZT)
Zidovudine is a pyrimidine 2′,3′-dideoxyribonucleoside compound having a 3′-azido substituent and thymine as the nucleobase. It has a role as an antiviral drug, an antimetabolite and a HIV-1 reverse transcriptase inhibitor. It is a pyrimidine 2′,3′-dideoxyribonucleoside and an azide.
| Catalog Number | PIPB-0566 |
| Alternative Name(s) | zidovudine Azidothymidine 3'-Azido-3'-deoxythymidine Retrovir |
| Research Area | 2' 3'-Dideoxy Nucleosides |
| Molecular Formula | C10H13N5O5 |
| CAS# | 30516-87-1 |
| SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)N=[N+]=[N-] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/3-n3-ddt-azt-item-10629.html |