Zidovudine
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02590 |
| Alternative Name(s) | AZT; 3'-Azido-3'-deoxythymidine; Retrovis; Timazid; Retrovir; Nc 602670; |
| Research Area | A potent and selective inhibitor of HIV-1 replication. |
| Molecular Formula | C10H13N5O4 |
| CAS# | 30516-87-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1)N([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)C=C(C)C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02590.html |
| Additional Information | NULL |