Zidovudine 25mg
Zidovudine is a nucleoside analog reverse-transcriptase inhibitor (NRTI), a type of antiretroviral drug used for the treatment of HIV/AIDS infection. Azidothymidine decreases CRISPR-mediated homology directed repair (HDR) efficiency.
| Trivial name | Zidovudine 25mg |
| Catalog Number | A15428-25 |
| Alternative Name(s) | 3??-azido-3??-deoxy-thymidine |
| Molecular Formula | C10H13N5O4 |
| CAS# | 30516-87-1 |
| SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)N=[N+]=[N-] |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/zidovudine.html |
