L-carnosine
L-carnosine is an antioxidant naturally found in skeletal muscle, brain tissue, and the heart, it can scavenge oxygen free radicals and transition metal ions, block protein-protein and protein-DNA cross-links induced by hypochlorite anions and toxic aldehydes, inhibit nonenzymatic protein glycation induced by aldose and ketose reducing sugars and inhibit the formation of toxic advanced glycation end products (AGE).
| Trivial name | / |
| Catalog Number | CSN23303 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C9H14N4O3 |
| CAS# | 305-84-0 |
| Purity | ≥98% |
| SMILES | OC([C@@H](NC(CCN)=O)CC1=CN=CN1)=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/l-carnosine.html |
