Chlorambucil
Chlorambucil is an orally-active antineoplastic aromatic nitrogen mustard. Chlorambucil alkylates and cross-links DNA during all phases of the cell cycle, resulting in disruption of DNA function, cell cycle arrest, and apoptosis.
| Catalog Number | T0975 |
| Alternative Name(s) | CB-1348 , Chloroambucil , WR-139013 |
| Research Area | DNA Damage/DNA Repair |
| Molecular Formula | C14H19Cl2NO2 |
| CAS# | 305-03-3 |
| Purity | 99.58% |
| SMILES | OC(=O)CCCc1ccc(cc1)N(CCCl)CCCl |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/Chlorambucil |
| Additional Information | https://www.targetmol.com/datasheet/T0975 |