Chlorambucil
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30552 |
| Alternative Name(s) | 4-[Bis(2-chloroethyl)amino]benzenebutanoic Acid; 4-[p-[Bis(2-chloroethyl)amino]phenyl]butyric Acid; 4-[Bis(2-chloroethyl)amino]benzenebutanoic Acid; 4-[p-[Bis(2-chloroethyl)amino]phenyl]butyric Acid; Ambochlorin; Amboclorin; CB 1348; Chlorambucil; Chloram |
| Research Area | Chlorambucil is a alkylating agent that is used as an chemotherapy drug in the treatment of chronic lymphocytic leukemia. Chlorambucil is also used to treat non-Hodgkin's lymphoma (NHL) and Hodgkin's disease. |
| Molecular Formula | C14H19Cl2NO2 |
| CAS# | 305-03-03 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClCCN(C1=CC=C(CCCC(O)=O)C=C1)CCCl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30552.html |
| Additional Information | NULL |