Tanaproget
Tanaproget (NSP-989) is a novel nonsteroidal progesterone receptor agonist which can bind to the PR from various species with a higher relative affinity than reference steroidal progestins.IC50 value: 0.1 nM (EC50, induce alkaline phosphatase activity) Target: progesterone receptorTanaproget represents a potential first-in-class nonsteroidal PR agonist for contraception with improved safety and side effect profiles versus currently available steroidal oral contraceptives.in vitro: In T47D cells, TNPR induces alkaline phosphatase activity with an EC(50) value of 0.1 nm, comparable with potent steroidal progestins such as medroxyprogesterone acetate (MPA) and trimegestone (TMG), albeit with a reduced efficacy ( approximately 60%). In a mammal
| Trivial name | NSP-989 |
| Catalog Number | E7698 |
| Molecular Formula | C18H19N3O3S.HCl |
| CAS# | 304853-42-7 |
| Inchi | InChI=1S/C18H19N3O3S.ClH/c1-21(16-4-2-3-9-19-16)10-11-24-14-7-5-13(6-8-14)12-15-17(22)20-18(23)25-15;/h2-9,15H,10-12H2,1H3,(H,20,22,23);1H |
| Inchi Key | XRSCTTPDKURIIJ-UHFFFAOYSA-N |
| SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3.Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/tanaproget.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7698-tanaproget-chemical-structure-tube.png |