Hydralazine HCl
Hydralazine HCl is a hydrochloride salt of hydralazine, which is a direct-acting smooth muscle relaxant used to treat hypertension by acting as a vasodilator primarily in arteries and arterioles.
| Trivial name | N/A |
| Catalog Number | S2562 |
| Molecular Formula | C30H28N6O2.2HCl.XH2O |
| CAS# | 304-20-1 |
| SMILES | C1CN=C(N1)C2=CC=C(C=C2)NC(=O)C=CC3=CC=C(C=C3)C=CC(=O)NC4=CC=C(C=C4)C5=NCCN5.Cl.Cl |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/Hydralazine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Hydralazine-hydrochloride-chemical-structure-S2562.gif |